AA25459
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $7.00 | $5.00 | - + | |
2mg | 98% | in stock | $9.00 | $6.00 | - + | |
5mg | 98% | in stock | $12.00 | $9.00 | - + | |
10mg | 98% | in stock | $18.00 | $13.00 | - + | |
100mg | 98% | in stock | $60.00 | $42.00 | - + | |
250mg | 95% | in stock | $122.00 | $86.00 | - + | |
1g | 95% | in stock | $275.00 | $193.00 | - + | |
5g | 95% | in stock | $1,008.00 | $706.00 | - + | |
10g | 95% | in stock | $1,879.00 | $1,316.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA25459 |
Chemical Name: | H-Glu-Trp-OH |
CAS Number: | 38101-59-6 |
Molecular Formula: | C16H19N3O5 |
Molecular Weight: | 333.3392 |
MDL Number: | MFCD00037953 |
SMILES: | OC(=O)CC[C@@H](C(=O)N[C@H](C(=O)O)Cc1c[nH]c2c1cccc2)N |
Complexity: | 484 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 5 |
Rotatable Bond Count: | 8 |
XLogP3: | -2.7 |
Voprosy virusologii 20120101
Biopolymers 20080101
International immunopharmacology 20070301
Bulletin of experimental biology and medicine 20060201
Bioorganicheskaia khimiia 19990701