AB42871
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 96% | in stock | $6.00 | $4.00 | - + | |
10g | 96% | in stock | $8.00 | $6.00 | - + | |
25g | 96% | in stock | $16.00 | $11.00 | - + | |
100g | 96% | in stock | $37.00 | $26.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42871 |
Chemical Name: | (R)-(+)-N-Benzyl-1-phenylethylamine |
CAS Number: | 38235-77-7 |
Molecular Formula: | C15H17N |
Molecular Weight: | 211.3022 |
MDL Number: | MFCD00015010 |
SMILES: | C[C@H](c1ccccc1)NCc1ccccc1 |
Complexity: | 178 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 3.2 |
Organic & biomolecular chemistry 20120814
Organic letters 20120106
Organic letters 20090507
Organic & biomolecular chemistry 20050307
The Journal of organic chemistry 20030530