logo
Home  > Inhibitors/Agonists  > Membrane Transporter/Ion Channel  > Potassium Channel  > 6-amino-2-imino-4-(piperidin-1-yl)-1,2-dihydropyrimidin-1-ol

AB51877

38304-91-5 | 6-amino-2-imino-4-(piperidin-1-yl)-1,2-dihydropyrimidin-1-ol

Packsize Purity Availability Price Discounted Price    Quantity
1mg 95% in stock $6.00 $4.00 -   +
1g 95% in stock $11.00 $8.00 -   +
5g 95% in stock $24.00 $17.00 -   +
10g 95% in stock $34.00 $24.00 -   +
25g 95% in stock $55.00 $38.00 -   +
100g 95% in stock $162.00 $113.00 -   +
250g 95% in stock $312.00 $218.00 -   +
1kg 95% in stock $1,140.00 $798.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB51877
Chemical Name: 6-amino-2-imino-4-(piperidin-1-yl)-1,2-dihydropyrimidin-1-ol
CAS Number: 38304-91-5
Molecular Formula: C9H15N5O
Molecular Weight: 209.2483
MDL Number: MFCD16039334
SMILES: Nc1cc(nc([n+]1[O-])N)N1CCCCC1
NSC Number: 757106

 

Computed Properties
Complexity: 329  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 3  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 1  
XLogP3: 1.2  

 

 

Upstream Synthesis Route 
  • The compound 6-(1-Piperidinyl)-2,4-pyrimidinediamine-3-oxide, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. Its unique structure containing both a piperidine ring and a pyrimidine core makes it a valuable intermediate for the synthesis of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, $name$ is utilized as a key starting material or intermediate in the production of bioactive compounds such as potential anticancer agents, antibacterial agents, and antiviral drugs. Its functional groups provide valuable sites for further modifications through various chemical reactions, enabling the creation of structurally diverse molecules with desired properties.Moreover, the presence of the piperidine ring in the molecule confers specific pharmacological properties, making it a preferred choice in drug discovery and development. By incorporating 6-(1-Piperidinyl)-2,4-pyrimidinediamine-3-oxide into synthetic pathways, chemists can access new chemical entities with enhanced biological activities and improved pharmacokinetic profiles.Overall, the application of 6-(1-Piperidinyl)-2,4-pyrimidinediamine-3-oxide in chemical synthesis showcases its importance as a valuable building block for the creation of novel compounds with potential therapeutic benefits and industrial applications.
Literature
FEATURED PRODUCTS