AF57922
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $89.00 | $62.00 | - + | |
1g | 95% | in stock | $249.00 | $174.00 | - + | |
5g | 95% | in stock | $675.00 | $472.00 | - + | |
10g | 95% | in stock | $1,178.00 | $824.00 | - + | |
25g | 95% | in stock | $2,344.00 | $1,641.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF57922 |
Chemical Name: | 6,7-Dichloro-1h-indole-2-carboxylic acid |
CAS Number: | 383132-13-6 |
Molecular Formula: | C9H5Cl2NO2 |
Molecular Weight: | 230.0475 |
MDL Number: | MFCD02664417 |
SMILES: | OC(=O)c1cc2c([nH]1)c(Cl)c(cc2)Cl |
Complexity: | 249 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.2 |
6,7-Dichloro-1H-indole-2-carboxylic acid is a versatile compound widely utilized in chemical synthesis. It serves as a crucial building block in the creation of various pharmaceuticals, agrochemicals, and other fine chemicals. Due to its unique structural properties, this indole derivative enables the synthesis of complex molecules with diverse biological activities. Its presence in the synthetic pathway imparts specific functionalities and structural motifs necessary for the development of target molecules with enhanced properties. In pharmaceutical research, it is commonly employed as a key intermediate in the synthesis of bioactive compounds targeting specific biological pathways. The chemical versatility of 6,7-Dichloro-1H-indole-2-carboxylic acid makes it an indispensable tool in the hands of synthetic chemists striving to design and create novel compounds with potential therapeutic applications.