AD39270
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | 2 weeks | $161.00 | $113.00 | - + | |
1g | 95% | 2 weeks | $312.00 | $219.00 | - + | |
5g | 95% | 2 weeks | $1,171.00 | $820.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD39270 |
Chemical Name: | 4-(4-Methoxy-3-nitrophenyl)morpholine |
CAS Number: | 383870-96-0 |
Molecular Formula: | C11H14N2O4 |
Molecular Weight: | 238.23986000000008 |
MDL Number: | MFCD11036297 |
SMILES: | COc1ccc(cc1[N+](=O)[O-])N1CCOCC1 |
The versatile compound 4-(4-Methoxy-3-nitrophenyl)morpholine, often utilized in chemical synthesis, plays a crucial role in a variety of applications. One main use of this compound is as a key intermediate in the synthesis of pharmaceuticals and agrochemicals. Its unique molecular structure allows for facile modification of the morpholine ring, enabling the synthesis of target molecules with tailored properties and functionalities. Furthermore, 4-(4-Methoxy-3-nitrophenyl)morpholine is a valuable building block in the preparation of organic dyes and pigments, due to its ability to impart specific color properties. Additionally, this compound has found significance in material science, specifically in the development of advanced polymers and materials with enhanced properties. Overall, the utilization of 4-(4-Methoxy-3-nitrophenyl)morpholine in chemical synthesis offers a wide range of opportunities for the creation of novel compounds with diverse applications.