AB67673
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $41.00 | $29.00 | - + | |
5g | 95% | in stock | $76.00 | $53.00 | - + | |
25g | 95% | in stock | $98.00 | $69.00 | - + | |
100g | 95% | in stock | $240.00 | $168.00 | - + | |
500g | 95% | in stock | $737.00 | $516.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB67673 |
Chemical Name: | 4-Hydroxybenzoic acid n-nonyl ester |
CAS Number: | 38713-56-3 |
Molecular Formula: | C16H24O3 |
Molecular Weight: | 264.36 |
MDL Number: | MFCD00016483 |
SMILES: | CCCCCCCCCOC(=O)c1ccc(cc1)O |
Complexity: | 232 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 10 |
XLogP3: | 5.9 |
Journal of agricultural and food chemistry 20020703