logo
Home  > TRIOXSALEN

AB80133

3902-71-4 | TRIOXSALEN

Packsize Purity Availability Price Discounted Price    Quantity
1g 98% in stock $38.00 $27.00 -   +
5g 98% in stock $110.00 $77.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB80133
Chemical Name: TRIOXSALEN
CAS Number: 3902-71-4
Molecular Formula: C14H12O3
Molecular Weight: 228.2433
MDL Number: MFCD00005010
SMILES: Cc1cc2c(o1)c(C)c1c(c2)c(C)cc(=O)o1

 

Upstream Synthesis Route
  • Trimethylpsoralen, also known as TMP, is a potent chemical compound widely utilized in chemical synthesis for its unique properties. This chemical is commonly employed as a photosensitizer due to its ability to undergo photochemical reactions upon exposure to ultraviolet (UV) light.In chemical synthesis, Trimethylpsoralen acts as a crucial agent in various photoreactions such as photooxidation, photocycloaddition, and photodimerization. These photochemical reactions enable the selective modification of organic molecules, leading to the synthesis of complex compounds with high efficiency and precision.Moreover, Trimethylpsoralen finds significant application in the synthesis of bioactive molecules, pharmaceuticals, and natural products. Its ability to induce specific chemical transformations under controlled light conditions makes it an invaluable tool for chemists seeking to develop novel compounds and explore new synthetic pathways.Overall, Trimethylpsoralen plays a key role in advancing the field of chemical synthesis by enabling precise and selective photochemical reactions, opening up possibilities for the creation of diverse and sophisticated molecules with tailored properties and functionalities.
FEATURED PRODUCTS