AB54971
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $30.00 | $21.00 | - + | |
25g | 95% | in stock | $114.00 | $80.00 | - + | |
100g | 95% | in stock | $323.00 | $226.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB54971 |
Chemical Name: | 3,4-Diaminobenzophenone |
CAS Number: | 39070-63-8 |
Molecular Formula: | C13H12N2O |
Molecular Weight: | 212.2472 |
MDL Number: | MFCD00007727 |
SMILES: | O=C(c1ccc(c(c1)N)N)c1ccccc1 |
Complexity: | 248 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2 |
International journal of plant genomics 20110101
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20100201
Current protocols in nucleic acid chemistry 20071201
Analytical chemistry 20060415
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20051201
Chemical & pharmaceutical bulletin 20030701