AF70750
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $14.00 | $10.00 | - + | |
1g | 95% | in stock | $24.00 | $17.00 | - + | |
5g | 95% | in stock | $41.00 | $29.00 | - + | |
25g | 95% | in stock | $103.00 | $72.00 | - + | |
100g | 95% | in stock | $283.00 | $198.00 | - + | |
500g | 95% | in stock | $1,413.00 | $989.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF70750 |
Chemical Name: | 3,5-Dibromosulfanilamide |
CAS Number: | 39150-45-3 |
Molecular Formula: | C6H6Br2N2O2S |
Molecular Weight: | 329.9970399999999 |
MDL Number: | MFCD00014783 |
SMILES: | Nc1c(Br)cc(cc1Br)S(=O)(=O)N |
Complexity: | 265 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.2 |
Bioorganic & medicinal chemistry 20120215
Bioorganic & medicinal chemistry 20110815
Bioorganic & medicinal chemistry 20110201
Journal of medicinal chemistry 20100311
Bioorganic & medicinal chemistry 20071201
Journal of medicinal chemistry 20030522