AB51104
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $6.00 | $4.00 | - + | |
5mg | 98% | in stock | $7.00 | $5.00 | - + | |
10mg | 98% | in stock | $11.00 | $8.00 | - + | |
25mg | 98% | in stock | $24.00 | $17.00 | - + | |
50mg | 98% | in stock | $44.00 | $31.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB51104 |
Chemical Name: | Tiplaxtinin |
CAS Number: | 393105-53-8 |
Molecular Formula: | C24H16F3NO4 |
Molecular Weight: | 439.3833 |
MDL Number: | MFCD09475615 |
SMILES: | OC(=O)C(=O)c1cn(c2c1cc(cc2)c1ccc(cc1)OC(F)(F)F)Cc1ccccc1 |
Complexity: | 671 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 5.8 |
Bioorganic & medicinal chemistry letters 20130801
Glia 20130501
Bioorganic & medicinal chemistry letters 20111001
Diabetes 20110701
International journal of molecular medicine 20100701
European journal of medicinal chemistry 20080401
Thrombosis and haemostasis 20080401
Thrombosis research 20080101
Thrombosis and haemostasis 20061201
Arteriosclerosis, thrombosis, and vascular biology 20061001
Bioorganic & medicinal chemistry letters 20050801
Journal of thrombosis and haemostasis : JTH 20050601
Journal of medicinal chemistry 20040701