AF56592
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $13.00 | $9.00 | - + | |
1g | 97% | in stock | $15.00 | $10.00 | - + | |
5g | 97% | in stock | $47.00 | $33.00 | - + | |
25g | 98% | in stock | $89.00 | $63.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF56592 |
Chemical Name: | 2,5-Bis(trifluoromethyl)benzaldehyde |
CAS Number: | 395-64-2 |
Molecular Formula: | C9H4F6O |
Molecular Weight: | 242.1179 |
MDL Number: | MFCD00674087 |
SMILES: | O=Cc1cc(ccc1C(F)(F)F)C(F)(F)F |
Complexity: | 256 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 7 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.2 |
2,5-Bis(trifluoromethyl)benzaldehyde is a versatile compound used in various chemical synthesis applications. This aromatic aldehyde is known for its unique properties that make it a valuable building block in organic chemistry. In chemical synthesis, 2,5-Bis(trifluoromethyl)benzaldehyde serves as a key intermediate for the preparation of a wide range of organic compounds. Its trifluoromethyl groups confer significant electron-withdrawing properties, making it a useful reagent for introducing fluorine-containing moieties into organic molecules. This compound is particularly favored in the pharmaceutical industry for the synthesis of drug molecules due to its ability to enhance pharmacological properties. Additionally, 2,5-Bis(trifluoromethyl)benzaldehyde is employed in material science for the production of advanced materials with tailored properties. Its application extends to the synthesis of agrochemicals, dyes, and other fine chemicals, highlighting its importance in modern chemical research and development.