logo
Home  > Chemistry  > Organic Building Blocks  > Aldehydes  > 2,5-Bis(trifluoromethyl)benzaldehyde

AF56592

395-64-2 | 2,5-Bis(trifluoromethyl)benzaldehyde

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $15.00 $10.00 -   +
1g 97% in stock $16.00 $11.00 -   +
5g 97% in stock $38.00 $26.00 -   +
25g 97% in stock $122.00 $85.00 -   +
100g 97% in stock $336.00 $235.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AF56592
Chemical Name: 2,5-Bis(trifluoromethyl)benzaldehyde
CAS Number: 395-64-2
Molecular Formula: C9H4F6O
Molecular Weight: 242.1179
MDL Number: MFCD00674087
SMILES: O=Cc1cc(ccc1C(F)(F)F)C(F)(F)F

 

Computed Properties
Complexity: 256  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 16  
Hydrogen Bond Acceptor Count: 7  
Rotatable Bond Count: 1  
XLogP3: 3.2  

 

 

Upstream Synthesis Route
  • 2,5-Bis(trifluoromethyl)benzaldehyde is a versatile compound used in various chemical synthesis applications. This aromatic aldehyde is known for its unique properties that make it a valuable building block in organic chemistry. In chemical synthesis, 2,5-Bis(trifluoromethyl)benzaldehyde serves as a key intermediate for the preparation of a wide range of organic compounds. Its trifluoromethyl groups confer significant electron-withdrawing properties, making it a useful reagent for introducing fluorine-containing moieties into organic molecules. This compound is particularly favored in the pharmaceutical industry for the synthesis of drug molecules due to its ability to enhance pharmacological properties. Additionally, 2,5-Bis(trifluoromethyl)benzaldehyde is employed in material science for the production of advanced materials with tailored properties. Its application extends to the synthesis of agrochemicals, dyes, and other fine chemicals, highlighting its importance in modern chemical research and development.
FEATURED PRODUCTS