logo
Home  > Chemistry  > Heterocyclic Building Blocks  > Benzimidazoles  > 5-Bromobenzo[d]imidazol-2-one

AD37514

39513-26-3 | 5-Bromobenzo[d]imidazol-2-one

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $8.00 $5.00 -   +
1g 97% in stock $12.00 $9.00 -   +
5g 97% in stock $20.00 $14.00 -   +
10g 97% in stock $35.00 $25.00 -   +
25g 97% in stock $86.00 $61.00 -   +
100g 97% in stock $265.00 $186.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD37514
Chemical Name: 5-Bromobenzo[d]imidazol-2-one
CAS Number: 39513-26-3
Molecular Formula: C7H5BrN2O
Molecular Weight: 213.0314
MDL Number: MFCD01893032
SMILES: Brc1ccc2c(c1)[nH]c(=O)[nH]2

 

Computed Properties
Complexity: 185  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 11  
Hydrogen Bond Acceptor Count: 1  
Hydrogen Bond Donor Count: 2  
XLogP3: 1.8  

 

 

Upstream Synthesis Route
  • The upstream synthesis of 5-Bromobenzo[d]imidazol-2-one typically involves the following steps:
    
    1. Starting from 2-Aminobenzonitrile, which undergoes diazotization using hydrochloric acid and sodium nitrite to form the corresponding diazonium salt.
    2. The diazonium salt then undergoes Sandmeyer reaction with copper(I) bromide to introduce the bromine, producing 5-bromo-2-aminobenzonitrile.
    3. The brominated compound is then cyclized using carbonyl-containing reagents like diethyl oxalate or ethyl cyanoacetate in the presence of a base (e.g., potassium carbonate) to form the imidazole ring, resulting in the target molecule, 5-Bromobenzo[d]imidazol-2-one.
    
    Each step involves purification techniques such as recrystallization or column chromatography to ensure the purity of the intermediates and the final product. Additionally, analytical methods like NMR and mass spectroscopy are used to confirm the structure of the compounds at each stage.
FEATURED PRODUCTS