AB42741
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $11.00 | $8.00 | - + | |
10g | 95% | in stock | $30.00 | $21.00 | - + | |
25g | 95% | in stock | $60.00 | $42.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42741 |
Chemical Name: | 1-Benzyl-3-oxo-piperidine-4-carboxylic acid ethyl ester |
CAS Number: | 39514-19-7 |
Molecular Formula: | C15H19NO3 |
Molecular Weight: | 261.3163 |
MDL Number: | MFCD00044512 |
SMILES: | CCOC(=O)C1CCN(CC1=O)Cc1ccccc1 |
Complexity: | 323 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 5 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 2.2 |
Journal of medicinal chemistry 20101111
Bioorganic & medicinal chemistry letters 20101101
Acta crystallographica. Section E, Structure reports online 20081201