AI49689
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $13.00 | $9.00 | - + | |
5g | 95% | in stock | $58.00 | $41.00 | - + | |
10g | 95% | in stock | $84.00 | $59.00 | - + | |
25g | 95% | in stock | $166.00 | $116.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI49689 |
Chemical Name: | Glycine,N-(carboxymethyl)-N-[(9,10-dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenyl)methyl]- |
CAS Number: | 3952-78-1 |
Molecular Formula: | C19H15NO8 |
Molecular Weight: | 385.3243 |
MDL Number: | MFCD00149067 |
SMILES: | OC(=O)CN(Cc1cc2c(c(c1O)O)C(=O)c1c(C2=O)cccc1)CC(=O)O |
Glycine, N-(carboxymethyl)-N-[(9,10-dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenyl)methyl] is a valuable compound in chemical synthesis due to its versatile applications. This compound is commonly used as a building block in organic chemistry, particularly in the synthesis of complex molecules and pharmaceutical intermediates. By incorporating Glycine, N-(carboxymethyl)-N-[(9,10-dihydro-3,4-dihydroxy-9,10-dioxo-2-anthracenyl)methyl], chemists can introduce specific functionalities and structural motifs into target molecules with precision. Its carboxyl and amino groups allow for various chemical modifications through coupling reactions, making it an essential component in the preparation of novel compounds for research and industrial purposes.