AB68671
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% HPLC | in stock | $7.00 | $5.00 | - + | |
5g | 97% HPLC | in stock | $21.00 | $15.00 | - + | |
10g | 97% HPLC | in stock | $26.00 | $18.00 | - + | |
25g | 97% HPLC | in stock | $57.00 | $40.00 | - + | |
100g | 97% HPLC | in stock | $217.00 | $152.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB68671 |
Chemical Name: | 5,7-Dimethylisatin |
CAS Number: | 39603-24-2 |
Molecular Formula: | C10H9NO2 |
Molecular Weight: | 175.1840 |
MDL Number: | MFCD00047219 |
SMILES: | Cc1cc(C)c2c(c1)C(=O)C(=O)N2 |
Complexity: | 262 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 1.4 |
Journal of medicinal chemistry 20070419
Bioorganic & medicinal chemistry letters 20031020