AF68062
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $172.00 | $120.00 | - + | |
5mg | 95% | in stock | $786.00 | $550.00 | - + | |
10mg | 95% | in stock | $1,258.00 | $880.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF68062 |
Chemical Name: | Pasireotide (for the salt) |
CAS Number: | 396091-77-3 |
Molecular Formula: | C62H73N11O13 |
Molecular Weight: | 1180.3089 |
MDL Number: | MFCD28167814 |
SMILES: | OC(=O)C[C@@H](C(=O)O)N.NCCCC[C@@H]1NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H]2N(C(=O)[C@@H](NC(=O)[C@@H](NC1=O)Cc1ccc(cc1)OCc1ccccc1)Cc1ccccc1)C[C@@H](C2)OC(=O)NCCN)c1ccccc1)Cc1c[nH]c2c1cccc2 |