AB66454
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $35.00 | $24.00 | - + | |
5g | 96% | in stock | $131.00 | $92.00 | - + | |
10g | 96% | in stock | $203.00 | $142.00 | - + | |
25g | 96% | in stock | $387.00 | $271.00 | - + | |
100g | 96% | in stock | $1,132.00 | $793.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB66454 |
Chemical Name: | 4-[(4-Trifluoromethyl)phenoxy]phenol |
CAS Number: | 39634-42-9 |
Molecular Formula: | C13H9F3O2 |
Molecular Weight: | 254.2046 |
MDL Number: | MFCD00192527 |
SMILES: | Oc1ccc(cc1)Oc1ccc(cc1)C(F)(F)F |
Complexity: | 252 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.3 |
Bioresource technology 20100401
Environmental toxicology and chemistry 20090401