AB42778
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $14.00 | $10.00 | - + | |
1g | 95% | in stock | $17.00 | $12.00 | - + | |
5g | 95% | in stock | $34.00 | $24.00 | - + | |
25g | 95% | in stock | $161.00 | $113.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42778 |
Chemical Name: | (1S)-4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl chloride |
CAS Number: | 39637-74-6 |
Molecular Formula: | C10H13ClO3 |
Molecular Weight: | 216.6614 |
MDL Number: | MFCD00135626 |
SMILES: | ClC(=O)[C@@]12CC[C@](C2(C)C)(C(=O)O1)C |
Complexity: | 336 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.3 |
The Journal of organic chemistry 20040220
Angewandte Chemie (International ed. in English) 20020402