AD36593
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $7.00 | $5.00 | - + | |
5g | ≥97% | in stock | $19.00 | $13.00 | - + | |
10g | 97% | in stock | $26.00 | $18.00 | - + | |
25g | 97% | in stock | $59.00 | $41.00 | - + | |
100g | 97% | in stock | $233.00 | $163.00 | - + | |
250g | 95% | in stock | $517.00 | $362.00 | - + | |
500g | 95% | in stock | $1,033.00 | $723.00 | - + | |
1000g | 95% | in stock | $2,062.00 | $1,443.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD36593 |
Chemical Name: | tert-Butyl 3,5-dioxopiperidine-1-carboxylate |
CAS Number: | 396731-40-1 |
Molecular Formula: | C10H15NO4 |
Molecular Weight: | 213.2304 |
MDL Number: | MFCD14706038 |
SMILES: | O=C(N1CC(=O)CC(=O)C1)OC(C)(C)C |
Complexity: | 287 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.7 |
Tert-Butyl 3,5-dioxopiperidine-1-carboxylate serves as a valuable building block in chemical synthesis, particularly in the realm of organic chemistry. This compound finds widespread application as a precursor in the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals. Due to its versatile structure and reactivity, tert-Butyl 3,5-dioxopiperidine-1-carboxylate can participate in a range of synthetic transformations, including acylation, alkylation, and cyclization reactions. Its incorporation into organic molecules can often impart desirable properties or functionalities, making it a key intermediate in the development of novel chemical entities with diverse applications.