AB61655
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $6.00 | $4.00 | - + | |
1g | 97% | in stock | $7.00 | $5.00 | - + | |
5g | 97% | in stock | $16.00 | $11.00 | - + | |
10g | 97% | in stock | $31.00 | $22.00 | - + | |
25g | 97% | in stock | $72.00 | $51.00 | - + | |
100g | 97% | in stock | $263.00 | $184.00 | - + | |
500g | 97% | in stock | $920.00 | $644.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB61655 |
Chemical Name: | 2-Chloro-3-nitrobenzoic acid |
CAS Number: | 3970-35-2 |
Molecular Formula: | C7H4ClNO4 |
Molecular Weight: | 201.5640 |
MDL Number: | MFCD00007069 |
SMILES: | OC(=O)c1cccc(c1Cl)[N+](=O)[O-] |
NSC Number: | 92742 |
Complexity: | 227 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.9 |
Journal of combinatorial chemistry 20090101
Chemical & pharmaceutical bulletin 20010901