AB52992
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $9.00 | $6.00 | - + | |
25g | 98% | in stock | $12.00 | $8.00 | - + | |
100g | 98% | in stock | $29.00 | $20.00 | - + | |
500g | 98% | in stock | $142.00 | $99.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52992 |
Chemical Name: | Boc-Tyr-OH |
CAS Number: | 3978-80-1 |
Molecular Formula: | C14H19NO5 |
Molecular Weight: | 281.3044 |
MDL Number: | MFCD00037179 |
SMILES: | OC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)OC(C)(C)C |
Complexity: | 342 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 1.5 |
Analytica chimica acta 20120420
Biosensors & bioelectronics 20091115
The Journal of organic chemistry 20091106
Nature chemical biology 20090101
Journal of molecular recognition : JMR 20090101
Journal of combinatorial chemistry 20040101