logo
Home  > tert-Butyl 3-amino-6,7-dihydro-1h-pyrazolo[4,3-c]pyridine-5(4h)-carboxylate

AF87412

398491-64-0 | tert-Butyl 3-amino-6,7-dihydro-1h-pyrazolo[4,3-c]pyridine-5(4h)-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $23.00 $16.00 -   +
250mg 97% in stock $42.00 $30.00 -   +
1g 97% in stock $146.00 $102.00 -   +
5g 97% in stock $600.00 $420.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AF87412
Chemical Name: tert-Butyl 3-amino-6,7-dihydro-1h-pyrazolo[4,3-c]pyridine-5(4h)-carboxylate
CAS Number: 398491-64-0
Molecular Formula: C11H18N4O2
Molecular Weight: 238.2862
MDL Number: MFCD12964106
SMILES: O=C(N1CCc2c(C1)c(N)n[nH]2)OC(C)(C)C

 

Upstream Synthesis Route
  • In chemical synthesis, tert-Butyl 3-amino-6,7-dihydro-1H-pyrazolo[4,3-c]pyridine-5(4H)-carboxylate serves as a versatile building block with unique reactivity. Its incorporation into organic reactions can lead to the formation of complex molecular structures with potential applications in pharmaceuticals, agrochemicals, and materials science. By leveraging its specific molecular features, such as the tert-butyl and amino groups, this compound can participate in various transformations including acylation, alkylation, and cyclization reactions. Furthermore, the presence of the pyrazolo-pyridine core offers opportunities for diverse functional group manipulations, enabling the synthesis of novel molecular scaffolds for drug discovery and chemical research.
FEATURED PRODUCTS