AB44759
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $6.00 | - + | |
5g | 95% | in stock | $13.00 | $10.00 | - + | |
10g | 95% | in stock | $22.00 | $16.00 | - + | |
25g | 95% | in stock | $44.00 | $31.00 | - + | |
100g | 95% | in stock | $167.00 | $117.00 | - + | |
500g | 95% | in stock | $578.00 | $405.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44759 |
Chemical Name: | 4,4'-Dibromobenzophenone |
CAS Number: | 3988-03-2 |
Molecular Formula: | C13H8Br2O |
Molecular Weight: | 340.0100 |
MDL Number: | MFCD00016330 |
SMILES: | O=C(c1ccc(cc1)Br)c1ccc(cc1)Br |
NSC Number: | 86518 |
Complexity: | 214 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 5 |
Archives of environmental contamination and toxicology 20100401
Acta crystallographica. Section E, Structure reports online 20090801
Analytica chimica acta 20070102
Journal of medicinal chemistry 20040422