AB67536
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $17.00 | $12.00 | - + | |
5g | 98% | in stock | $55.00 | $39.00 | - + | |
25g | 98% | in stock | $163.00 | $114.00 | - + | |
100g | 98% | in stock | $441.00 | $309.00 | - + | |
500g | 98% | in stock | $1,536.00 | $1,075.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB67536 |
Chemical Name: | 4'-Fluorochalcone |
CAS Number: | 399-10-0 |
Molecular Formula: | C15H11FO |
Molecular Weight: | 226.2456 |
MDL Number: | MFCD00017961 |
SMILES: | Fc1ccc(cc1)C(=O)/C=C/c1ccccc1 |
NSC Number: | 135634 |
Complexity: | 271 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.2 |
Bioorganic & medicinal chemistry letters 20110101
Journal of medicinal chemistry 20091126