AB73581
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $27.00 | $19.00 | - + | |
5g | 98% | in stock | $98.00 | $69.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB73581 |
Chemical Name: | Ethyl 2-amino-5,6,7,8-tetrahydro-4h-cyclohepta[b]thiophene-3-carboxylate |
CAS Number: | 40106-13-6 |
Molecular Formula: | C12H17NO2S |
Molecular Weight: | 239.3338800000001 |
MDL Number: | MFCD00216932 |
SMILES: | CCOC(=O)c1c(N)sc2c1CCCCC2 |
NSC Number: | 158551 |
Complexity: | 259 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.8 |
Journal of medicinal chemistry 20020117