logo
Home  > Life Science  > Amino acids  > Amino acid derivatives  > Cis-4-hydroxy-L-proline methyl ester, HCl

AB46430

40126-30-5 | Cis-4-hydroxy-L-proline methyl ester, HCl

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $20.00 $14.00 -   +
1g 95% in stock $20.00 $14.00 -   +
5g 95% in stock $25.00 $18.00 -   +
25g 95% in stock $98.00 $68.00 -   +
50g 95% in stock $193.00 $135.00 -   +
100g 95% in stock $314.00 $220.00 -   +
500g 95% in stock $1,482.00 $1,037.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB46430
Chemical Name: Cis-4-hydroxy-L-proline methyl ester, HCl
CAS Number: 40126-30-5
Molecular Formula: C6H12ClNO3
Molecular Weight: 181.6174
MDL Number: MFCD00237835
SMILES: COC(=O)[C@@H]1C[C@@H](CN1)O.Cl

 

Computed Properties
Complexity: 137  
Covalently-Bonded Unit Count: 2  
Defined Atom Stereocenter Count: 2  
Heavy Atom Count: 11  
Hydrogen Bond Acceptor Count: 4  
Hydrogen Bond Donor Count: 3  
Rotatable Bond Count: 2  

 

 

Upstream Synthesis Route 
  • Methyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate hydrochloride serves as a versatile building block in chemical synthesis due to its unique structure and reactivity. This compound plays a crucial role in the development of various pharmaceuticals, agrochemicals, and materials. As a chiral compound, it enables the synthesis of enantiomerically pure molecules, making it a valuable tool in the production of chirally pure drugs and fine chemicals. Additionally, its hydrochloride form enhances solubility and stability, facilitating its use in a wide range of synthetic transformations and reactions. Its application in asymmetric synthesis and medicinal chemistry highlights its importance in the advancement of modern chemical research and development.
FEATURED PRODUCTS