AB69006
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $7.00 | $5.00 | - + | |
1g | 98% | in stock | $15.00 | $11.00 | - + | |
5g | 98% | in stock | $41.00 | $29.00 | - + | |
10g | 98% | in stock | $80.00 | $56.00 | - + | |
25g | 98% | in stock | $200.00 | $140.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB69006 |
Chemical Name: | 5-Bromoindole-3-acetic acid |
CAS Number: | 40432-84-6 |
Molecular Formula: | C10H8BrNO2 |
Molecular Weight: | 254.08 |
MDL Number: | MFCD00005637 |
SMILES: | OC(=O)Cc1c[nH]c2c1cc(Br)cc2 |
NSC Number: | 88145 |
Complexity: | 234 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.1 |
Journal of medicinal chemistry 20140313
Cancer gene therapy 20100601
Bioorganic & medicinal chemistry 20070701
Journal of medicinal chemistry 20070111
Cancer gene therapy 20040701
Bioorganic & medicinal chemistry letters 20020916
Zeitschrift fur Naturforschung. C, Journal of biosciences 20020101