AI49892
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $13.00 | $9.00 | - + | |
1g | 95% | in stock | $18.00 | $12.00 | - + | |
5g | 95% | in stock | $23.00 | $16.00 | - + | |
25g | 95% | in stock | $88.00 | $61.00 | - + | |
100g | 95% | in stock | $278.00 | $195.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI49892 |
Chemical Name: | 1,2,3,4-Tetra-o-acetyl-beta-d-xylopyranose |
CAS Number: | 4049-33-6 |
Molecular Formula: | C13H18O9 |
Molecular Weight: | 318.2766199999999 |
MDL Number: | MFCD00069790 |
SMILES: | CC(=O)O[C@@H]1CO[C@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Complexity: | 458 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 9 |
Rotatable Bond Count: | 8 |
XLogP3: | -0.2 |
Journal of medicinal chemistry 20081225