AB67055
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 90% | in stock | $16.00 | $11.00 | - + | |
5g | 90% | in stock | $18.00 | $12.00 | - + | |
25g | 90% | in stock | $19.00 | $13.00 | - + | |
100g | 90% | in stock | $48.00 | $34.00 | - + | |
500g | 90% | in stock | $99.00 | $69.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB67055 |
Chemical Name: | 4-Chloro-1,8-naphthalic anhydride |
CAS Number: | 4053-08-1 |
Molecular Formula: | C12H5ClO3 |
Molecular Weight: | 232.6193 |
MDL Number: | MFCD00006928 |
SMILES: | O=C1OC(=O)c2c3c1cccc3c(cc2)Cl |
Complexity: | 341 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 3.2 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20030501
Acta poloniae pharmaceutica 20010101