AI49935
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $16.00 | $11.00 | - + | |
10g | 98% | in stock | $20.00 | $14.00 | - + | |
1kg | 98% | in stock | $1,907.00 | $1,335.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI49935 |
Chemical Name: | 5'-O-(4,4'-Dimethoxytrityl)thymidine |
CAS Number: | 40615-39-2 |
Molecular Formula: | C31H32N2O7 |
Molecular Weight: | 544.595 |
MDL Number: | MFCD00010113 |
SMILES: | COc1ccc(cc1)C(c1ccc(cc1)OC)(c1ccccc1)OC[C@H]1O[C@H](C[C@@H]1O)n1cc(C)c(=O)[nH]c1=O |
Complexity: | 879 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 40 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 9 |
XLogP3: | 3.4 |
Nucleosides, nucleotides & nucleic acids 20110101
Journal of medicinal chemistry 20020912