AF82866
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $39.00 | $27.00 | - + | |
5mg | 98% | in stock | $87.00 | $61.00 | - + | |
10mg | 98% | in stock | $165.00 | $116.00 | - + | |
25mg | 98% | in stock | $356.00 | $249.00 | - + | |
50mg | 98% | in stock | $626.00 | $438.00 | - + | |
100mg | 98% | in stock | $1,041.00 | $729.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF82866 |
Chemical Name: | Caccinh-a01 |
CAS Number: | 407587-33-1 |
Molecular Formula: | C18H21NO4S |
Molecular Weight: | 347.42864 |
MDL Number: | MFCD02919058 |
SMILES: | OC(=O)c1c(sc2c1CCC(C2)C(C)(C)C)NC(=O)c1ccco1 |
Complexity: | 504 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 5.1 |
European journal of biochemistry 19760102