AF56766
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $21.00 | $15.00 | - + | |
10g | 95% | in stock | $35.00 | $25.00 | - + | |
25g | 95% | in stock | $80.00 | $56.00 | - + | |
100g | 95% | in stock | $288.00 | $201.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF56766 |
Chemical Name: | N-Boc-L-Homoserine |
CAS Number: | 41088-86-2 |
Molecular Formula: | C9H17NO5 |
Molecular Weight: | 219.235 |
MDL Number: | MFCD00057839 |
SMILES: | OCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Complexity: | 233 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 0.2 |
Boc-L-Homoserine is a versatile compound widely used in chemical synthesis, particularly in peptide and pharmaceutical chemistry. With its Boc (tert-butoxycarbonyl) protecting group, Boc-L-Homoserine serves as a valuable building block for the efficient and selective synthesis of complex peptides and peptidomimetics.In peptide synthesis, Boc-L-Homoserine can be employed for the preparation of both linear and cyclic peptides, allowing for the introduction of homoserine residues at specific positions within the peptide sequence. The Boc protecting group offers stability and can be selectively removed under mild conditions to reveal the reactive functional group on the homoserine moiety, enabling further manipulation and derivatization.Furthermore, Boc-L-Homoserine plays a crucial role in the synthesis of pharmaceutical compounds by serving as a key intermediate in the construction of bioactive molecules. Its incorporation into drug candidates can confer desirable properties such as enhanced bioavailability, improved stability, and targeted activity. By strategically incorporating Boc-L-Homoserine into the molecular structure of pharmaceutical agents, chemists can tailor the pharmacokinetic and pharmacodynamics profile of the final compound, thereby optimizing its therapeutic efficacy.Overall, the application of Boc-L-Homoserine in chemical synthesis offers a powerful tool for the design and development of peptides and pharmaceuticals with tailored properties and functionalities. Its versatility and compatibility with various synthetic strategies make it a valuable asset in the pursuit of novel drug discovery and peptide-based therapeutics.