AB44754
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $6.00 | $4.00 | - + | |
1g | 97% | in stock | $7.00 | $5.00 | - + | |
5g | 97% | in stock | $17.00 | $12.00 | - + | |
10g | 97% | in stock | $29.00 | $21.00 | - + | |
25g | 97% | in stock | $72.00 | $51.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44754 |
Chemical Name: | 4,4'-Biphenyldiboronic acid |
CAS Number: | 4151-80-8 |
Molecular Formula: | C12H12B2O4 |
Molecular Weight: | 241.8433 |
MDL Number: | MFCD00151795 |
SMILES: | OB(c1ccc(cc1)c1ccc(cc1)B(O)O)O |
Complexity: | 221 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 3 |
Bioorganic & medicinal chemistry letters 20100601
Journal of medicinal chemistry 20091008
Inorganic chemistry 20080804
Journal of medicinal chemistry 20020718