AG14207
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG14207 |
Chemical Name: | 3-Methyl-3-phenylpentanedioic acid |
CAS Number: | 4160-92-3 |
Molecular Formula: | C12H14O4 |
Molecular Weight: | 222.2372 |
MDL Number: | MFCD00020491 |
SMILES: | OC(=O)CC(c1ccccc1)(CC(=O)O)C |
NSC Number: | 51135 |
Complexity: | 250 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.5 |
Journal of medicinal chemistry 20020606