AF87776
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $139.00 | $97.00 | - + | |
5g | 97% | in stock | $387.00 | $271.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF87776 |
Chemical Name: | N-Benzyl-2-nitrobenzenesulfonamide |
CAS Number: | 42060-32-2 |
Molecular Formula: | C13H12N2O4S |
Molecular Weight: | 292.3104 |
MDL Number: | MFCD00426424 |
SMILES: | [O-][N+](=O)c1ccccc1S(=O)(=O)NCc1ccccc1 |
Complexity: | 421 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.2 |
Journal of medicinal chemistry 20120112