AF58069
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $29.00 | $20.00 | - + | |
1g | 95% | in stock | $41.00 | $29.00 | - + | |
5g | 95% | in stock | $103.00 | $72.00 | - + | |
10g | 95% | in stock | $169.00 | $118.00 | - + | |
25g | 95% | in stock | $333.00 | $233.00 | - + | |
100g | 95% | in stock | $971.00 | $680.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF58069 |
Chemical Name: | L-1,2,3,4-Tetrahydronorharman-3-carboxylic acid |
CAS Number: | 42438-90-4 |
Molecular Formula: | C12H12N2O2 |
Molecular Weight: | 216.2359 |
MDL Number: | MFCD00272641 |
SMILES: | OC(=O)[C@H]1NCc2c(C1)c1ccccc1[nH]2 |
Complexity: | 295 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 1 |
XLogP3: | -1.2 |
Bioorganic & medicinal chemistry 20111101
Journal of medicinal chemistry 20100422
Bioorganic & medicinal chemistry 20081101
The journal of physical chemistry. B 20080925
Chemical research in toxicology 20050601
Preparative biochemistry & biotechnology 20040201
Bioorganic & medicinal chemistry letters 20020225