AD28743
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
10g | 98% | in stock | $10.00 | $7.00 | - + | |
25g | 98% | in stock | $22.00 | $15.00 | - + | |
100g | 98% | in stock | $85.00 | $59.00 | - + | |
500g | 98% | in stock | $420.00 | $294.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD28743 |
Chemical Name: | 4-Fluoro-3-nitrobenzaldehyde |
CAS Number: | 42564-51-2 |
Molecular Formula: | C7H4FNO3 |
Molecular Weight: | 169.10996320000004 |
MDL Number: | MFCD01861388 |
SMILES: | O=Cc1ccc(c(c1)[N+](=O)[O-])F |
Complexity: | 192 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.4 |
Journal of the American Chemical Society 20030219