AF87663
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $12.00 | $9.00 | - + | |
1g | 98% | in stock | $22.00 | $16.00 | - + | |
5g | 98% | in stock | $108.00 | $76.00 | - + | |
25g | 98% | in stock | $362.00 | $254.00 | - + | |
100g | 98% | in stock | $1,285.00 | $899.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF87663 |
Chemical Name: | (Trifluoromethane)sulfonylbenzene |
CAS Number: | 426-58-4 |
Molecular Formula: | C7H5F3O2S |
Molecular Weight: | 210.1736 |
MDL Number: | MFCD00159083 |
SMILES: | FC(S(=O)(=O)c1ccccc1)(F)F |
Complexity: | 256 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.7 |
Organic letters 20100702
Organic letters 20030904
The Journal of organic chemistry 20030530