AF58852
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $19.00 | $13.00 | - + | |
5g | 95% | in stock | $36.00 | $25.00 | - + | |
10g | 95% | in stock | $56.00 | $39.00 | - + | |
25g | 95% | in stock | $102.00 | $71.00 | - + | |
100g | 95% | in stock | $346.00 | $242.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF58852 |
Chemical Name: | 1,2,3,4-Tetrahydro-2,4-dioxo-5-pyrimidinecarboxylic acid methyl ester |
CAS Number: | 42821-92-1 |
Molecular Formula: | C6H6N2O4 |
Molecular Weight: | 170.1228 |
MDL Number: | MFCD06203889 |
SMILES: | COC(=O)c1c[nH]c(=O)[nH]c1=O |
NSC Number: | 602880 |
Complexity: | 281 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | -0.9 |
Journal of medicinal chemistry 20090108