AD30416
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $43.00 | $30.00 | - + | |
5mg | ≥98% | in stock | $83.00 | $58.00 | - + | |
10mg | ≥98% | in stock | $129.00 | $90.00 | - + | |
50mg | 98% | in stock | $234.00 | $164.00 | - + | |
1g | 98% | in stock | $1,139.00 | $798.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD30416 |
Chemical Name: | SMI 4A |
CAS Number: | 438190-29-5 |
Molecular Formula: | C11H6F3NO2S |
Molecular Weight: | 273.2310 |
MDL Number: | MFCD01152003 |
SMILES: | O=C1NC(=O)/C(=C/c2cccc(c2)C(F)(F)F)/S1 |
Complexity: | 406 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.1 |
Journal of medicinal chemistry 20121011
Journal of medicinal chemistry 20090108
Bioorganic & medicinal chemistry letters 20050901