AB57807
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $50.00 | $35.00 | - + | |
5g | 95 | in stock | $89.00 | $63.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB57807 |
Chemical Name: | 1-Adamantyl isothiocyanate |
CAS Number: | 4411-26-1 |
Molecular Formula: | C11H15NS |
Molecular Weight: | 193.3085 |
MDL Number: | MFCD00074736 |
SMILES: | S=C=NC12CC3CC(C2)CC(C1)C3 |
NSC Number: | 529585 |
Complexity: | 237 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 4.2 |
Chemical biology & drug design 20120101
Bioorganic & medicinal chemistry letters 20101101
European journal of medicinal chemistry 20070201
Bioorganic & medicinal chemistry 20040515