AD28695
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 99% | in stock | $6.00 | $4.00 | - + | |
5g | 99% | in stock | $12.00 | $8.00 | - + | |
10g | 99% | in stock | $18.00 | $12.00 | - + | |
25g | 99% | in stock | $29.00 | $20.00 | - + | |
100g | 99% | in stock | $109.00 | $76.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD28695 |
Chemical Name: | 6-Fluoropyridine-3-boronic acid, pinacol ester |
CAS Number: | 444120-95-0 |
Molecular Formula: | C11H15BFNO2 |
Molecular Weight: | 223.0517 |
MDL Number: | MFCD03412792 |
SMILES: | Fc1ccc(cn1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 257 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
Journal of medicinal chemistry 20120308