AI50649
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $15.00 | $10.00 | - + | |
5g | 95% | in stock | $16.00 | $11.00 | - + | |
25g | 95% | in stock | $34.00 | $24.00 | - + | |
100g | 95% | in stock | $65.00 | $45.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI50649 |
Chemical Name: | 2-Fluoro-4-nitroanisole |
CAS Number: | 455-93-6 |
Molecular Formula: | C7H6FNO3 |
Molecular Weight: | 171.1258 |
MDL Number: | MFCD00061095 |
SMILES: | COc1ccc(cc1F)[N+](=O)[O-] |
NSC Number: | 10335 |
Complexity: | 171 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.3 |
The Journal of organic chemistry 20080307