AG17284
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $15.00 | $10.00 | - + | |
5g | 96% | in stock | $28.00 | $19.00 | - + | |
25g | 96% | in stock | $69.00 | $48.00 | - + | |
100g | 96% | in stock | $270.00 | $189.00 | - + | |
500g | 96% | in stock | $1,317.00 | $922.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG17284 |
Chemical Name: | O-Benzyl-L-Serine |
CAS Number: | 4726-96-9 |
Molecular Formula: | C10H13NO3 |
Molecular Weight: | 195.2151 |
MDL Number: | MFCD00065937 |
SMILES: | N[C@H](C(=O)O)COCc1ccccc1 |
Complexity: | 178 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | -2 |
Bioorganic & medicinal chemistry 20120915
Analytical and bioanalytical chemistry 20100701
Organic & biomolecular chemistry 20090207
Bioorganic & medicinal chemistry letters 20080315
Drug metabolism and disposition: the biological fate of chemicals 20050101
The Journal of physiology 20040615
The Journal of organic chemistry 20031128
Organic letters 20010208