AB45115
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $8.00 | $5.00 | - + | |
1g | 97% | in stock | $9.00 | $6.00 | - + | |
5g | 97% | in stock | $23.00 | $16.00 | - + | |
10g | 97% | in stock | $35.00 | $25.00 | - + | |
25g | 97% | in stock | $85.00 | $59.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45115 |
Chemical Name: | 4-Nitroindole |
CAS Number: | 4769-97-5 |
Molecular Formula: | C8H6N2O2 |
Molecular Weight: | 162.1454 |
MDL Number: | MFCD00010056 |
SMILES: | [O-][N+](=O)c1cccc2c1cc[nH]2 |
Complexity: | 190 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.6 |
Toxins 20110801
Phytochemistry 20090501
Journal of agricultural and food chemistry 20060503