AG23458
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $51.00 | $36.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG23458 |
Chemical Name: | 3-Fluoro-2-methyl-6-nitroaniline |
CAS Number: | 485832-96-0 |
Molecular Formula: | C7H7FN2O2 |
Molecular Weight: | 170.1411 |
MDL Number: | MFCD03787364 |
SMILES: | [O-][N+](=O)c1ccc(c(c1N)C)F |
Complexity: | 183 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.1 |
3-Fluoro-2-methyl-6-nitroaniline is a versatile compound widely used in chemical synthesis due to its unique properties. In organic chemistry, it serves as a valuable building block for creating complex molecules with specific functional groups. This compound is particularly valuable for introducing fluorine, methyl, and nitro groups into various chemical structures, allowing for precise control over the properties of the final products.