AB70510
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 96% | in stock | $16.00 | $11.00 | - + | |
1g | 96% | in stock | $18.00 | $13.00 | - + | |
25g | 96% | in stock | $448.00 | $314.00 | - + | |
100g | 96% | in stock | $1,317.00 | $922.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB70510 |
Chemical Name: | Allyl toluene-4-sulfonate |
CAS Number: | 4873-09-0 |
Molecular Formula: | C10H12O3S |
Molecular Weight: | 212.2655 |
MDL Number: | MFCD00093777 |
SMILES: | C=CCOS(=O)(=O)c1ccc(cc1)C |
Complexity: | 268 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.2 |
The Journal of organic chemistry 20030725