AB57799
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $13.00 | $9.00 | - + | |
5g | 98% | in stock | $16.00 | $11.00 | - + | |
10g | 98% | in stock | $20.00 | $14.00 | - + | |
25g | 98% | in stock | $48.00 | $34.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB57799 |
Chemical Name: | 1-Adamantaneacetic acid |
CAS Number: | 4942-47-6 |
Molecular Formula: | C12H18O2 |
Molecular Weight: | 194.2701 |
MDL Number: | MFCD00074728 |
SMILES: | OC(=O)CC12CC3CC(C2)CC(C1)C3 |
NSC Number: | 310162 |
Complexity: | 228 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.2 |
Medicinal chemistry (Shariqah (United Arab Emirates)) 20121101
Bioorganic & medicinal chemistry letters 20111115
Nature chemical biology 20110801
Chemical communications (Cambridge, England) 20100814
Journal of medicinal chemistry 20100211
Bioconjugate chemistry 20090819
Chemistry (Weinheim an der Bergstrasse, Germany) 20090101
Acta biochimica Polonica 20090101
The Journal of organic chemistry 20080321
Bioorganic & medicinal chemistry 20070701
Biochemistry. Biokhimiia 20070501
Chemistry (Weinheim an der Bergstrasse, Germany) 20070101
Journal of peptide science : an official publication of the European Peptide Society 20061201
Journal of medicinal chemistry 20051215
Organic letters 20050915
Bioorganic & medicinal chemistry 20040515
Bioorganicheskaia khimiia 20040101
The journal of peptide research : official journal of the American Peptide Society 20010101