AI51080
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $556.00 | $390.00 | - + | |
5g | 96% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI51080 |
Chemical Name: | 4-(Propan-2-ylsulfonyl)phenol |
CAS Number: | 494794-53-5 |
Molecular Formula: | C9H12O3S |
Molecular Weight: | 200.2548 |
MDL Number: | MFCD21985519 |
SMILES: | CC(S(=O)(=O)c1ccc(cc1)O)C |
Complexity: | 243 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.5 |
The Journal of organic chemistry 20030124