AG57179
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 99% | 2 weeks | $40.00 | $28.00 | - + | |
100g | 99% | 2 weeks | $80.00 | $56.00 | - + | |
500g | 99% | 2 weeks | $170.00 | $119.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AG57179 |
Chemical Name: | oleic acid, monoester with oxybis(propanediol) |
CAS Number: | 49553-76-6 |
Molecular Formula: | C24H46O6 |
Molecular Weight: | 430.6184 |
MDL Number: | MFCD29767851 |
SMILES: | CCCCCCCCC=CCCCCCCCC(=O)OC(CCOCCC(O)O)O |